C12H24N4O3S — CID 106423667
N-[2-(5-methyl-1,2,4-oxadiazol-3-yl)ethyl]-4-(propan-2-ylamino)butane-1-sulfonamide (PubChem CID 106423667) has the molecular formula C12H24N4O3S and a molecular weight of 304.42 g/mol. Its IUPAC name is N-[2-(5-methyl-1,2,4-oxadiazol-3-yl)ethyl]-4-(propan-2-ylamino)butane-1-sulfonamide.
| Compound Name | N-[2-(5-methyl-1,2,4-oxadiazol-3-yl)ethyl]-4-(propan-2-ylamino)butane-1-sulfonamide |
|---|---|
| PubChem CID | 106423667 |
| Molecular Formula | C12H24N4O3S |
| Molecular Weight | 304.42 g/mol |
| Exact Mass | 304.16 |
| IUPAC Name | N-[2-(5-methyl-1,2,4-oxadiazol-3-yl)ethyl]-4-(propan-2-ylamino)butane-1-sulfonamide |
| SMILES | Cc1nc(CCNS(=O)(=O)CCCCNC(C)C)no1 |
| InChI | InChI=1S/C12H24N4O3S/c1-10(2)13-7-4-5-9-20(17,18)14-8-6-12-15-11(3)19-16-12/h10,13-14H,4-9H2,1-3H3 |
| InChIKey | CNSJSOQRUIRCQS-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 97.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.42 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|