C10H20N4O3S — CID 114185428
N-(1,2,4-oxadiazol-3-ylmethyl)-4-(propan-2-ylamino)butane-1-sulfonamide (PubChem CID 114185428) has the molecular formula C10H20N4O3S and a molecular weight of 276.36 g/mol. Its IUPAC name is N-(1,2,4-oxadiazol-3-ylmethyl)-4-(propan-2-ylamino)butane-1-sulfonamide.
| Compound Name | N-(1,2,4-oxadiazol-3-ylmethyl)-4-(propan-2-ylamino)butane-1-sulfonamide |
|---|---|
| PubChem CID | 114185428 |
| Molecular Formula | C10H20N4O3S |
| Molecular Weight | 276.36 g/mol |
| Exact Mass | 276.13 |
| IUPAC Name | N-(1,2,4-oxadiazol-3-ylmethyl)-4-(propan-2-ylamino)butane-1-sulfonamide |
| SMILES | CC(C)NCCCCS(=O)(=O)NCc1ncon1 |
| InChI | InChI=1S/C10H20N4O3S/c1-9(2)11-5-3-4-6-18(15,16)13-7-10-12-8-17-14-10/h8-9,11,13H,3-7H2,1-2H3 |
| InChIKey | MVSRZILSWUSLPI-UHFFFAOYSA-N |
| XLogP | 0.27 |
| TPSA | 97.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.36 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|