C14H22F2N2O2S — CID 106055191
N-[(2,4-difluorophenyl)methyl]-4-(propan-2-ylamino)butane-1-sulfonamide (PubChem CID 106055191) has the molecular formula C14H22F2N2O2S and a molecular weight of 320.41 g/mol. Its IUPAC name is N-[(2,4-difluorophenyl)methyl]-4-(propan-2-ylamino)butane-1-sulfonamide.
| Compound Name | N-[(2,4-difluorophenyl)methyl]-4-(propan-2-ylamino)butane-1-sulfonamide |
|---|---|
| PubChem CID | 106055191 |
| Molecular Formula | C14H22F2N2O2S |
| Molecular Weight | 320.41 g/mol |
| Exact Mass | 320.14 |
| IUPAC Name | N-[(2,4-difluorophenyl)methyl]-4-(propan-2-ylamino)butane-1-sulfonamide |
| SMILES | CC(C)NCCCCS(=O)(=O)NCc1ccc(F)cc1F |
| InChI | InChI=1S/C14H22F2N2O2S/c1-11(2)17-7-3-4-8-21(19,20)18-10-12-5-6-13(15)9-14(12)16/h5-6,9,11,17-18H,3-4,7-8,10H2,1-2H3 |
| InChIKey | HEYDZYHAIVXMTA-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.41 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|