C13H26N4O2S — CID 106094917
N-[(1,5-dimethylpyrazol-4-yl)methyl]-4-(propan-2-ylamino)butane-1-sulfonamide (PubChem CID 106094917) has the molecular formula C13H26N4O2S and a molecular weight of 302.44 g/mol. Its IUPAC name is N-[(1,5-dimethylpyrazol-4-yl)methyl]-4-(propan-2-ylamino)butane-1-sulfonamide.
| Compound Name | N-[(1,5-dimethylpyrazol-4-yl)methyl]-4-(propan-2-ylamino)butane-1-sulfonamide |
|---|---|
| PubChem CID | 106094917 |
| Molecular Formula | C13H26N4O2S |
| Molecular Weight | 302.44 g/mol |
| Exact Mass | 302.18 |
| IUPAC Name | N-[(1,5-dimethylpyrazol-4-yl)methyl]-4-(propan-2-ylamino)butane-1-sulfonamide |
| SMILES | Cc1c(CNS(=O)(=O)CCCCNC(C)C)cnn1C |
| InChI | InChI=1S/C13H26N4O2S/c1-11(2)14-7-5-6-8-20(18,19)16-10-13-9-15-17(4)12(13)3/h9,11,14,16H,5-8,10H2,1-4H3 |
| InChIKey | PIDRXZZEGKCPIR-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 76.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.44 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|