C10H17N3O4S — CID 106032725
4-[(1,5-dimethylpyrazol-4-yl)methylsulfamoyl]butanoic acid (PubChem CID 106032725) has the molecular formula C10H17N3O4S and a molecular weight of 275.33 g/mol. Its IUPAC name is 4-[(1,5-dimethylpyrazol-4-yl)methylsulfamoyl]butanoic acid.
| Compound Name | 4-[(1,5-dimethylpyrazol-4-yl)methylsulfamoyl]butanoic acid |
|---|---|
| PubChem CID | 106032725 |
| Molecular Formula | C10H17N3O4S |
| Molecular Weight | 275.33 g/mol |
| Exact Mass | 275.09 |
| IUPAC Name | 4-[(1,5-dimethylpyrazol-4-yl)methylsulfamoyl]butanoic acid |
| SMILES | Cc1c(CNS(=O)(=O)CCCC(=O)O)cnn1C |
| InChI | InChI=1S/C10H17N3O4S/c1-8-9(6-11-13(8)2)7-12-18(16,17)5-3-4-10(14)15/h6,12H,3-5,7H2,1-2H3,(H,14,15) |
| InChIKey | TYTPOLMJSDAQJR-UHFFFAOYSA-N |
| XLogP | 0.01 |
| TPSA | 101.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.33 |
| LogP ≤ 5 | 0.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |