C13H21Cl2N3O2S — CID 106059485
1,2-dichloro-4-[[methyl-[3-(propan-2-ylamino)propyl]sulfamoyl]amino]benzene (PubChem CID 106059485) has the molecular formula C13H21Cl2N3O2S and a molecular weight of 354.30 g/mol. Its IUPAC name is 1,2-dichloro-4-[[methyl-[3-(propan-2-ylamino)propyl]sulfamoyl]amino]benzene.
| Compound Name | 1,2-dichloro-4-[[methyl-[3-(propan-2-ylamino)propyl]sulfamoyl]amino]benzene |
|---|---|
| PubChem CID | 106059485 |
| Molecular Formula | C13H21Cl2N3O2S |
| Molecular Weight | 354.30 g/mol |
| Exact Mass | 353.07 |
| IUPAC Name | 1,2-dichloro-4-[[methyl-[3-(propan-2-ylamino)propyl]sulfamoyl]amino]benzene |
| SMILES | CC(C)NCCCN(C)S(=O)(=O)Nc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C13H21Cl2N3O2S/c1-10(2)16-7-4-8-18(3)21(19,20)17-11-5-6-12(14)13(15)9-11/h5-6,9-10,16-17H,4,7-8H2,1-3H3 |
| InChIKey | QKLMZFIBOQFKLJ-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.30 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|