C15H25N3O2S — CID 106057683
5-[[methyl-[3-(methylamino)propyl]sulfamoyl]amino]-1,2,3,4-tetrahydronaphthalene (PubChem CID 106057683) has the molecular formula C15H25N3O2S and a molecular weight of 311.45 g/mol. Its IUPAC name is 5-[[methyl-[3-(methylamino)propyl]sulfamoyl]amino]-1,2,3,4-tetrahydronaphthalene.
| Compound Name | 5-[[methyl-[3-(methylamino)propyl]sulfamoyl]amino]-1,2,3,4-tetrahydronaphthalene |
|---|---|
| PubChem CID | 106057683 |
| Molecular Formula | C15H25N3O2S |
| Molecular Weight | 311.45 g/mol |
| Exact Mass | 311.17 |
| IUPAC Name | 5-[[methyl-[3-(methylamino)propyl]sulfamoyl]amino]-1,2,3,4-tetrahydronaphthalene |
| SMILES | CNCCCN(C)S(=O)(=O)Nc1cccc2c1CCCC2 |
| InChI | InChI=1S/C15H25N3O2S/c1-16-11-6-12-18(2)21(19,20)17-15-10-5-8-13-7-3-4-9-14(13)15/h5,8,10,16-17H,3-4,6-7,9,11-12H2,1-2H3 |
| InChIKey | RQZNHVMJUNFIAW-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.45 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|