C11H17N3O4S — CID 107584640
methyl 3-[methyl-[(5-methyl-3-pyridinyl)sulfamoyl]amino]propanoate (PubChem CID 107584640) has the molecular formula C11H17N3O4S and a molecular weight of 287.34 g/mol. Its IUPAC name is methyl 3-[methyl-[(5-methyl-3-pyridinyl)sulfamoyl]amino]propanoate.
| Compound Name | methyl 3-[methyl-[(5-methyl-3-pyridinyl)sulfamoyl]amino]propanoate |
|---|---|
| PubChem CID | 107584640 |
| Molecular Formula | C11H17N3O4S |
| Molecular Weight | 287.34 g/mol |
| Exact Mass | 287.09 |
| IUPAC Name | methyl 3-[methyl-[(5-methyl-3-pyridinyl)sulfamoyl]amino]propanoate |
| SMILES | COC(=O)CCN(C)S(=O)(=O)Nc1cncc(C)c1 |
| InChI | InChI=1S/C11H17N3O4S/c1-9-6-10(8-12-7-9)13-19(16,17)14(2)5-4-11(15)18-3/h6-8,13H,4-5H2,1-3H3 |
| InChIKey | OVVMNMMAWSOELI-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 88.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.34 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |