C10H9Br2Cl2NO — CID 107788653
2-bromo-N-(4-bromo-2,3-dichlorophenyl)-2-methylpropanamide (PubChem CID 107788653) has the molecular formula C10H9Br2Cl2NO and a molecular weight of 389.90 g/mol. Its IUPAC name is 2-bromo-N-(4-bromo-2,3-dichlorophenyl)-2-methylpropanamide.
| Compound Name | 2-bromo-N-(4-bromo-2,3-dichlorophenyl)-2-methylpropanamide |
|---|---|
| PubChem CID | 107788653 |
| Molecular Formula | C10H9Br2Cl2NO |
| Molecular Weight | 389.90 g/mol |
| Exact Mass | 386.84 |
| IUPAC Name | 2-bromo-N-(4-bromo-2,3-dichlorophenyl)-2-methylpropanamide |
| SMILES | CC(C)(Br)C(=O)Nc1ccc(Br)c(Cl)c1Cl |
| InChI | InChI=1S/C10H9Br2Cl2NO/c1-10(2,12)9(16)15-6-4-3-5(11)7(13)8(6)14/h3-4H,1-2H3,(H,15,16) |
| InChIKey | VDVVCKKMULKYJM-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.90 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|