C12H12BrCl2NO3 — CID 113428627
4-(4-bromo-2,3-dichloroanilino)-2,2-dimethyl-4-oxobutanoic acid (PubChem CID 113428627) has the molecular formula C12H12BrCl2NO3 and a molecular weight of 369.04 g/mol. Its IUPAC name is 4-(4-bromo-2,3-dichloroanilino)-2,2-dimethyl-4-oxobutanoic acid.
| Compound Name | 4-(4-bromo-2,3-dichloroanilino)-2,2-dimethyl-4-oxobutanoic acid |
|---|---|
| PubChem CID | 113428627 |
| Molecular Formula | C12H12BrCl2NO3 |
| Molecular Weight | 369.04 g/mol |
| Exact Mass | 366.94 |
| IUPAC Name | 4-(4-bromo-2,3-dichloroanilino)-2,2-dimethyl-4-oxobutanoic acid |
| SMILES | CC(C)(CC(=O)Nc1ccc(Br)c(Cl)c1Cl)C(=O)O |
| InChI | InChI=1S/C12H12BrCl2NO3/c1-12(2,11(18)19)5-8(17)16-7-4-3-6(13)9(14)10(7)15/h3-4H,5H2,1-2H3,(H,16,17)(H,18,19) |
| InChIKey | SGDITQZCHPFUIF-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.04 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|