C11H13ClN2O3 — CID 83165894
4-[(4-chloro-3-pyridinyl)amino]-2,2-dimethyl-4-oxobutanoic acid (PubChem CID 83165894) has the molecular formula C11H13ClN2O3 and a molecular weight of 256.69 g/mol. Its IUPAC name is 4-[(4-chloro-3-pyridinyl)amino]-2,2-dimethyl-4-oxobutanoic acid.
| Compound Name | 4-[(4-chloro-3-pyridinyl)amino]-2,2-dimethyl-4-oxobutanoic acid |
|---|---|
| PubChem CID | 83165894 |
| Molecular Formula | C11H13ClN2O3 |
| Molecular Weight | 256.69 g/mol |
| Exact Mass | 256.06 |
| IUPAC Name | 4-[(4-chloro-3-pyridinyl)amino]-2,2-dimethyl-4-oxobutanoic acid |
| SMILES | CC(C)(CC(=O)Nc1cnccc1Cl)C(=O)O |
| InChI | InChI=1S/C11H13ClN2O3/c1-11(2,10(16)17)5-9(15)14-8-6-13-4-3-7(8)12/h3-4,6H,5H2,1-2H3,(H,14,15)(H,16,17) |
| InChIKey | PRSIJNGEOOLPQE-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 79.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.69 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |