C14H16BrCl2N3O — CID 107795879
N-(4-bromo-2,3-dichlorophenyl)-1-(3-methoxypropyl)-4-methylimidazol-2-amine (PubChem CID 107795879) has the molecular formula C14H16BrCl2N3O and a molecular weight of 393.11 g/mol. Its IUPAC name is N-(4-bromo-2,3-dichlorophenyl)-1-(3-methoxypropyl)-4-methylimidazol-2-amine.
| Compound Name | N-(4-bromo-2,3-dichlorophenyl)-1-(3-methoxypropyl)-4-methylimidazol-2-amine |
|---|---|
| PubChem CID | 107795879 |
| Molecular Formula | C14H16BrCl2N3O |
| Molecular Weight | 393.11 g/mol |
| Exact Mass | 390.99 |
| IUPAC Name | N-(4-bromo-2,3-dichlorophenyl)-1-(3-methoxypropyl)-4-methylimidazol-2-amine |
| SMILES | COCCCn1cc(C)nc1Nc1ccc(Br)c(Cl)c1Cl |
| InChI | InChI=1S/C14H16BrCl2N3O/c1-9-8-20(6-3-7-21-2)14(18-9)19-11-5-4-10(15)12(16)13(11)17/h4-5,8H,3,6-7H2,1-2H3,(H,18,19) |
| InChIKey | UUVWSKNNTFXUND-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 39.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.11 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|