C15H20BrN3O2 — CID 106579189
N-(4-bromo-3-methoxyphenyl)-1-(3-methoxypropyl)-4-methylimidazol-2-amine (PubChem CID 106579189) has the molecular formula C15H20BrN3O2 and a molecular weight of 354.25 g/mol. Its IUPAC name is N-(4-bromo-3-methoxyphenyl)-1-(3-methoxypropyl)-4-methylimidazol-2-amine.
| Compound Name | N-(4-bromo-3-methoxyphenyl)-1-(3-methoxypropyl)-4-methylimidazol-2-amine |
|---|---|
| PubChem CID | 106579189 |
| Molecular Formula | C15H20BrN3O2 |
| Molecular Weight | 354.25 g/mol |
| Exact Mass | 353.07 |
| IUPAC Name | N-(4-bromo-3-methoxyphenyl)-1-(3-methoxypropyl)-4-methylimidazol-2-amine |
| SMILES | COCCCn1cc(C)nc1Nc1ccc(Br)c(OC)c1 |
| InChI | InChI=1S/C15H20BrN3O2/c1-11-10-19(7-4-8-20-2)15(17-11)18-12-5-6-13(16)14(9-12)21-3/h5-6,9-10H,4,7-8H2,1-3H3,(H,17,18) |
| InChIKey | QTBYVOXXDQCKNL-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 48.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.25 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|