C14H16Cl2FN3O — CID 106578795
N-(2,6-dichloro-4-fluorophenyl)-1-(3-methoxypropyl)-4-methylimidazol-2-amine (PubChem CID 106578795) has the molecular formula C14H16Cl2FN3O and a molecular weight of 332.21 g/mol. Its IUPAC name is N-(2,6-dichloro-4-fluorophenyl)-1-(3-methoxypropyl)-4-methylimidazol-2-amine.
| Compound Name | N-(2,6-dichloro-4-fluorophenyl)-1-(3-methoxypropyl)-4-methylimidazol-2-amine |
|---|---|
| PubChem CID | 106578795 |
| Molecular Formula | C14H16Cl2FN3O |
| Molecular Weight | 332.21 g/mol |
| Exact Mass | 331.07 |
| IUPAC Name | N-(2,6-dichloro-4-fluorophenyl)-1-(3-methoxypropyl)-4-methylimidazol-2-amine |
| SMILES | COCCCn1cc(C)nc1Nc1c(Cl)cc(F)cc1Cl |
| InChI | InChI=1S/C14H16Cl2FN3O/c1-9-8-20(4-3-5-21-2)14(18-9)19-13-11(15)6-10(17)7-12(13)16/h6-8H,3-5H2,1-2H3,(H,18,19) |
| InChIKey | XADJSLQAQHFPLS-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 39.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.21 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|