About 2-(4-chlorophenyl)-5-octyl-5-propyl-1,2,4-triazolidine-3-thione
2-(4-chlorophenyl)-5-octyl-5-propyl-1,2,4-triazolidine-3-thione (PubChem CID 3818872) has the molecular formula C19H30ClN3S
and a molecular weight of 367.99 g/mol. Its IUPAC name is 2-(4-chlorophenyl)-5-octyl-5-propyl-1,2,4-triazolidine-3-thione.
Molecular Properties
| Compound Name | 2-(4-chlorophenyl)-5-octyl-5-propyl-1,2,4-triazolidine-3-thione |
| PubChem CID | 3818872 |
| Molecular Formula | C19H30ClN3S |
| Molecular Weight | 367.99 g/mol |
| Exact Mass | 367.18 |
| IUPAC Name | 2-(4-chlorophenyl)-5-octyl-5-propyl-1,2,4-triazolidine-3-thione |
| SMILES | CCCCCCCCC1(CCC)NC(=S)N(c2ccc(Cl)cc2)N1 |
| InChI | InChI=1S/C19H30ClN3S/c1-3-5-6-7-8-9-15-19(14-4-2)21-18(24)23(22-19)17-12-10-16(20)11-13-17/h10-13,22H,3-9,14-15H2,1-2H3,(H,21,24) |
| InChIKey | YJCMVERGLHUEOU-UHFFFAOYSA-N |
| XLogP | 5.79 |
| TPSA | 27.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 367.99 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 2-(4-chlorophenyl)-5-octyl-5-propyl-1,2,4-triazolidine-3-thione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-chlorophenyl)-5-octyl-5-propyl-1,2,4-triazolidine-3-thione?
The IUPAC name of 2-(4-chlorophenyl)-5-octyl-5-propyl-1,2,4-triazolidine-3-thione (CID 3818872) is 2-(4-chlorophenyl)-5-octyl-5-propyl-1,2,4-triazolidine-3-thione.
What is the SMILES notation for 2-(4-chlorophenyl)-5-octyl-5-propyl-1,2,4-triazolidine-3-thione?
The canonical SMILES for 2-(4-chlorophenyl)-5-octyl-5-propyl-1,2,4-triazolidine-3-thione is CCCCCCCCC1(CCC)NC(=S)N(c2ccc(Cl)cc2)N1.
What is the InChIKey of 2-(4-chlorophenyl)-5-octyl-5-propyl-1,2,4-triazolidine-3-thione?
The InChIKey is YJCMVERGLHUEOU-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H30ClN3S/c1-3-5-6-7-8-9-15-19(14-4-2)21-18(24)23(22-19)17-12-10-16(20)11-13-17/h10-13,22H,3-9,14-15H2,1-2H3,(H,21,24).
What are the key properties of 2-(4-chlorophenyl)-5-octyl-5-propyl-1,2,4-triazolidine-3-thione?
2-(4-chlorophenyl)-5-octyl-5-propyl-1,2,4-triazolidine-3-thione has a molecular weight of 367.99 g/mol, XLogP of 5.79, 10 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-chlorophenyl)-5-octyl-5-propyl-1,2,4-triazolidine-3-thione is sourced from PubChem (CID 3818872), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).