C13H18N4O2S — CID 133185819
5-butyl-5-methyl-2-(4-nitrophenyl)-1,2,4-triazolidine-3-thione (PubChem CID 133185819) has the molecular formula C13H18N4O2S and a molecular weight of 294.38 g/mol. Its IUPAC name is 5-butyl-5-methyl-2-(4-nitrophenyl)-1,2,4-triazolidine-3-thione.
| Compound Name | 5-butyl-5-methyl-2-(4-nitrophenyl)-1,2,4-triazolidine-3-thione |
|---|---|
| PubChem CID | 133185819 |
| Molecular Formula | C13H18N4O2S |
| Molecular Weight | 294.38 g/mol |
| Exact Mass | 294.12 |
| IUPAC Name | 5-butyl-5-methyl-2-(4-nitrophenyl)-1,2,4-triazolidine-3-thione |
| SMILES | CCCCC1(C)NC(=S)N(c2ccc([N+](=O)[O-])cc2)N1 |
| InChI | InChI=1S/C13H18N4O2S/c1-3-4-9-13(2)14-12(20)16(15-13)10-5-7-11(8-6-10)17(18)19/h5-8,15H,3-4,9H2,1-2H3,(H,14,20) |
| InChIKey | QNFNFCJJCPILCQ-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 70.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.38 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|