C21H19N5O3 — CID 134916955
2-methyl-4-(4-nitrophenyl)-6,6-diphenyl-1,2,4,5-tetrazinan-3-one (PubChem CID 134916955) has the molecular formula C21H19N5O3 and a molecular weight of 389.42 g/mol. Its IUPAC name is 2-methyl-4-(4-nitrophenyl)-6,6-diphenyl-1,2,4,5-tetrazinan-3-one.
| Compound Name | 2-methyl-4-(4-nitrophenyl)-6,6-diphenyl-1,2,4,5-tetrazinan-3-one |
|---|---|
| PubChem CID | 134916955 |
| Molecular Formula | C21H19N5O3 |
| Molecular Weight | 389.42 g/mol |
| Exact Mass | 389.15 |
| IUPAC Name | 2-methyl-4-(4-nitrophenyl)-6,6-diphenyl-1,2,4,5-tetrazinan-3-one |
| SMILES | CN1NC(c2ccccc2)(c2ccccc2)NN(c2ccc([N+](=O)[O-])cc2)C1=O |
| InChI | InChI=1S/C21H19N5O3/c1-24-20(27)25(18-12-14-19(15-13-18)26(28)29)23-21(22-24,16-8-4-2-5-9-16)17-10-6-3-7-11-17/h2-15,22-23H,1H3 |
| InChIKey | HBWYRWZHJZMOCE-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 90.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.42 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|