C22H26N6O4 — CID 134938951
4-N,1-dibutyl-2-N,3-bis(4-nitrophenyl)-1,3-diazetidine-2,4-diimine (PubChem CID 134938951) has the molecular formula C22H26N6O4 and a molecular weight of 438.49 g/mol. Its IUPAC name is 4-N,1-dibutyl-2-N,3-bis(4-nitrophenyl)-1,3-diazetidine-2,4-diimine.
| Compound Name | 4-N,1-dibutyl-2-N,3-bis(4-nitrophenyl)-1,3-diazetidine-2,4-diimine |
|---|---|
| PubChem CID | 134938951 |
| Molecular Formula | C22H26N6O4 |
| Molecular Weight | 438.49 g/mol |
| Exact Mass | 438.20 |
| IUPAC Name | 4-N,1-dibutyl-2-N,3-bis(4-nitrophenyl)-1,3-diazetidine-2,4-diimine |
| SMILES | CCCC/N=C1\N(CCCC)/C(=N\c2ccc([N+](=O)[O-])cc2)N1c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C22H26N6O4/c1-3-5-15-23-21-25(16-6-4-2)22(24-17-7-9-19(10-8-17)27(29)30)26(21)18-11-13-20(14-12-18)28(31)32/h7-14H,3-6,15-16H2,1-2H3/b23-21+,24-22+ |
| InChIKey | CQAICOOCUHEKIU-MBALSZOMSA-N |
| XLogP | 5.27 |
| TPSA | 117.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.49 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|