C16H25Br — CID 174984936
1-bromo-3,4-dimethyl-2-octylbenzene (PubChem CID 174984936) has the molecular formula C16H25Br and a molecular weight of 297.28 g/mol. Its IUPAC name is 1-bromo-3,4-dimethyl-2-octylbenzene.
| Compound Name | 1-bromo-3,4-dimethyl-2-octylbenzene |
|---|---|
| PubChem CID | 174984936 |
| Molecular Formula | C16H25Br |
| Molecular Weight | 297.28 g/mol |
| Exact Mass | 296.11 |
| IUPAC Name | 1-bromo-3,4-dimethyl-2-octylbenzene |
| SMILES | CCCCCCCCc1c(Br)ccc(C)c1C |
| InChI | InChI=1S/C16H25Br/c1-4-5-6-7-8-9-10-15-14(3)13(2)11-12-16(15)17/h11-12H,4-10H2,1-3H3 |
| InChIKey | NIFQGDCWJVROQJ-UHFFFAOYSA-N |
| XLogP | 5.97 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.28 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|