C17H25Br3 — CID 22756063
1,2,3-tribromo-4-undecylbenzene (PubChem CID 22756063) has the molecular formula C17H25Br3 and a molecular weight of 469.10 g/mol. Its IUPAC name is 1,2,3-tribromo-4-undecylbenzene.
| Compound Name | 1,2,3-tribromo-4-undecylbenzene |
|---|---|
| PubChem CID | 22756063 |
| Molecular Formula | C17H25Br3 |
| Molecular Weight | 469.10 g/mol |
| Exact Mass | 465.95 |
| IUPAC Name | 1,2,3-tribromo-4-undecylbenzene |
| SMILES | CCCCCCCCCCCc1ccc(Br)c(Br)c1Br |
| InChI | InChI=1S/C17H25Br3/c1-2-3-4-5-6-7-8-9-10-11-14-12-13-15(18)17(20)16(14)19/h12-13H,2-11H2,1H3 |
| InChIKey | KLCINZQPAMNZFL-UHFFFAOYSA-N |
| XLogP | 8.05 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.10 |
| LogP ≤ 5 | 8.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|