C22H36O8Si2 — CID 164816291
3-[2-methyl-6-(2-triethoxysilylethoxy)-4H-1,3,2-benzodioxasilin-2-yl]propyl prop-2-enoate (PubChem CID 164816291) has the molecular formula C22H36O8Si2 and a molecular weight of 484.69 g/mol. Its IUPAC name is 3-[2-methyl-6-(2-triethoxysilylethoxy)-4H-1,3,2-benzodioxasilin-2-yl]propyl prop-2-enoate.
| Compound Name | 3-[2-methyl-6-(2-triethoxysilylethoxy)-4H-1,3,2-benzodioxasilin-2-yl]propyl prop-2-enoate |
|---|---|
| PubChem CID | 164816291 |
| Molecular Formula | C22H36O8Si2 |
| Molecular Weight | 484.69 g/mol |
| Exact Mass | 484.19 |
| IUPAC Name | 3-[2-methyl-6-(2-triethoxysilylethoxy)-4H-1,3,2-benzodioxasilin-2-yl]propyl prop-2-enoate |
| SMILES | C=CC(=O)OCCC[Si]1(C)OCc2cc(OCC[Si](OCC)(OCC)OCC)ccc2O1 |
| InChI | InChI=1S/C22H36O8Si2/c1-6-22(23)25-13-10-15-31(5)29-18-19-17-20(11-12-21(19)30-31)24-14-16-32(26-7-2,27-8-3)28-9-4/h6,11-12,17H,1,7-10,13-16,18H2,2-5H3 |
| InChIKey | WFTUAVOATQIIKH-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 81.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.69 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|