C24H28O9Si2 — CID 164816429
[diacetyloxy-[2-[(2-phenyl-2-prop-2-enyl-4H-1,3,2-benzodioxasilin-6-yl)oxy]ethyl]silyl] acetate (PubChem CID 164816429) has the molecular formula C24H28O9Si2 and a molecular weight of 516.65 g/mol. Its IUPAC name is [diacetyloxy-[2-[(2-phenyl-2-prop-2-enyl-4H-1,3,2-benzodioxasilin-6-yl)oxy]ethyl]silyl] acetate.
| Compound Name | [diacetyloxy-[2-[(2-phenyl-2-prop-2-enyl-4H-1,3,2-benzodioxasilin-6-yl)oxy]ethyl]silyl] acetate |
|---|---|
| PubChem CID | 164816429 |
| Molecular Formula | C24H28O9Si2 |
| Molecular Weight | 516.65 g/mol |
| Exact Mass | 516.13 |
| IUPAC Name | [diacetyloxy-[2-[(2-phenyl-2-prop-2-enyl-4H-1,3,2-benzodioxasilin-6-yl)oxy]ethyl]silyl] acetate |
| SMILES | C=CC[Si]1(c2ccccc2)OCc2cc(OCC[Si](OC(C)=O)(OC(C)=O)OC(C)=O)ccc2O1 |
| InChI | InChI=1S/C24H28O9Si2/c1-5-14-34(23-9-7-6-8-10-23)29-17-21-16-22(11-12-24(21)33-34)28-13-15-35(30-18(2)25,31-19(3)26)32-20(4)27/h5-12,16H,1,13-15,17H2,2-4H3 |
| InChIKey | RCOQEBQJZYMIDP-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 106.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.65 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|