C14H33O9Si4 — CID 58952884
CID 58952884 (PubChem CID 58952884) has the molecular formula C14H33O9Si4 and a molecular weight of 457.75 g/mol.
| Compound Name | CID 58952884 |
|---|---|
| PubChem CID | 58952884 |
| Molecular Formula | C14H33O9Si4 |
| Molecular Weight | 457.75 g/mol |
| Exact Mass | 457.12 |
| IUPAC Name | — |
| SMILES | CO[Si](CC[Si]1(C)OCO[Si](C)(CCOCC2CO2)O[Si](C)O1)(OC)OC |
| InChI | InChI=1S/C14H33O9Si4/c1-15-27(16-2,17-3)10-9-26(6)21-13-20-25(5,22-24(4)23-26)8-7-18-11-14-12-19-14/h14H,7-13H2,1-6H3 |
| InChIKey | WXPGSXBMAVCKEG-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 86.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.75 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|