C40H88N2O5Si2 — CID 171623492
N,N-dibutyl-8-[[8-(dibutylamino)octyl-diethoxysilyl]oxy-diethoxysilyl]octan-1-amine (PubChem CID 171623492) has the molecular formula C40H88N2O5Si2 and a molecular weight of 733.32 g/mol. Its IUPAC name is N,N-dibutyl-8-[[8-(dibutylamino)octyl-diethoxysilyl]oxy-diethoxysilyl]octan-1-amine.
| Compound Name | N,N-dibutyl-8-[[8-(dibutylamino)octyl-diethoxysilyl]oxy-diethoxysilyl]octan-1-amine |
|---|---|
| PubChem CID | 171623492 |
| Molecular Formula | C40H88N2O5Si2 |
| Molecular Weight | 733.32 g/mol |
| Exact Mass | 732.62 |
| IUPAC Name | N,N-dibutyl-8-[[8-(dibutylamino)octyl-diethoxysilyl]oxy-diethoxysilyl]octan-1-amine |
| SMILES | CCCCN(CCCC)CCCCCCCC[Si](OCC)(OCC)O[Si](CCCCCCCCN(CCCC)CCCC)(OCC)OCC |
| InChI | InChI=1S/C40H88N2O5Si2/c1-9-17-33-41(34-18-10-2)37-29-25-21-23-27-31-39-48(43-13-5,44-14-6)47-49(45-15-7,46-16-8)40-32-28-24-22-26-30-38-42(35-19-11-3)36-20-12-4/h9-40H2,1-8H3 |
| InChIKey | WUPJWYDXVYPGNH-UHFFFAOYSA-N |
| XLogP | 11.51 |
| TPSA | 52.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 40 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 733.32 |
| LogP ≤ 5 | 11.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|