C23H50N2 — CID 174780488
N,N-dimethylpropan-1-amine;(Z)-octadec-9-en-1-amine (PubChem CID 174780488) has the molecular formula C23H50N2 and a molecular weight of 354.67 g/mol. Its IUPAC name is N,N-dimethylpropan-1-amine;(Z)-octadec-9-en-1-amine.
| Compound Name | N,N-dimethylpropan-1-amine;(Z)-octadec-9-en-1-amine |
|---|---|
| PubChem CID | 174780488 |
| Molecular Formula | C23H50N2 |
| Molecular Weight | 354.67 g/mol |
| Exact Mass | 354.40 |
| IUPAC Name | N,N-dimethylpropan-1-amine;(Z)-octadec-9-en-1-amine |
| SMILES | CCCCCCCC/C=C\CCCCCCCCN.CCCN(C)C |
| InChI | InChI=1S/C18H37N.C5H13N/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19;1-4-5-6(2)3/h9-10H,2-8,11-19H2,1H3;4-5H2,1-3H3/b10-9-; |
| InChIKey | FJQALPGYUBUCBW-KVVVOXFISA-N |
| XLogP | 6.94 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.67 |
| LogP ≤ 5 | 6.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|