About decan-1-amine;N,N-dimethylhex-4-en-1-amine
decan-1-amine;N,N-dimethylhex-4-en-1-amine (PubChem CID 159532821) has the molecular formula C18H40N2
and a molecular weight of 284.53 g/mol. Its IUPAC name is decan-1-amine;N,N-dimethylhex-4-en-1-amine.
Molecular Properties
| Compound Name | decan-1-amine;N,N-dimethylhex-4-en-1-amine |
| PubChem CID | 159532821 |
| Molecular Formula | C18H40N2 |
| Molecular Weight | 284.53 g/mol |
| Exact Mass | 284.32 |
| IUPAC Name | decan-1-amine;N,N-dimethylhex-4-en-1-amine |
| SMILES | CC=CCCCN(C)C.CCCCCCCCCCN |
| InChI | InChI=1S/C10H23N.C8H17N/c1-2-3-4-5-6-7-8-9-10-11;1-4-5-6-7-8-9(2)3/h2-11H2,1H3;4-5H,6-8H2,1-3H3 |
| InChIKey | MDFFWAFPJYTPOQ-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 284.53 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze decan-1-amine;N,N-dimethylhex-4-en-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of decan-1-amine;N,N-dimethylhex-4-en-1-amine?
The IUPAC name of decan-1-amine;N,N-dimethylhex-4-en-1-amine (CID 159532821) is decan-1-amine;N,N-dimethylhex-4-en-1-amine.
What is the SMILES notation for decan-1-amine;N,N-dimethylhex-4-en-1-amine?
The canonical SMILES for decan-1-amine;N,N-dimethylhex-4-en-1-amine is CC=CCCCN(C)C.CCCCCCCCCCN.
What is the InChIKey of decan-1-amine;N,N-dimethylhex-4-en-1-amine?
The InChIKey is MDFFWAFPJYTPOQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H23N.C8H17N/c1-2-3-4-5-6-7-8-9-10-11;1-4-5-6-7-8-9(2)3/h2-11H2,1H3;4-5H,6-8H2,1-3H3.
What are the key properties of decan-1-amine;N,N-dimethylhex-4-en-1-amine?
decan-1-amine;N,N-dimethylhex-4-en-1-amine has a molecular weight of 284.53 g/mol, XLogP of 4.99, 12 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for decan-1-amine;N,N-dimethylhex-4-en-1-amine is sourced from PubChem (CID 159532821), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).