C36H78O9S4Si3 — CID 87112069
triethoxy-[3-[2-[2-(2-triethoxysilylethyl)-5-[2-(3-triethoxysilylpropyldisulfanyl)ethyl]cyclohexyl]ethyldisulfanyl]propyl]silane (PubChem CID 87112069) has the molecular formula C36H78O9S4Si3 and a molecular weight of 867.54 g/mol. Its IUPAC name is triethoxy-[3-[2-[2-(2-triethoxysilylethyl)-5-[2-(3-triethoxysilylpropyldisulfanyl)ethyl]cyclohexyl]ethyldisulfanyl]propyl]silane.
| Compound Name | triethoxy-[3-[2-[2-(2-triethoxysilylethyl)-5-[2-(3-triethoxysilylpropyldisulfanyl)ethyl]cyclohexyl]ethyldisulfanyl]propyl]silane |
|---|---|
| PubChem CID | 87112069 |
| Molecular Formula | C36H78O9S4Si3 |
| Molecular Weight | 867.54 g/mol |
| Exact Mass | 866.38 |
| IUPAC Name | triethoxy-[3-[2-[2-(2-triethoxysilylethyl)-5-[2-(3-triethoxysilylpropyldisulfanyl)ethyl]cyclohexyl]ethyldisulfanyl]propyl]silane |
| SMILES | CCO[Si](CCCSSCCC1CCC(CC[Si](OCC)(OCC)OCC)C(CCSSCCC[Si](OCC)(OCC)OCC)C1)(OCC)OCC |
| InChI | InChI=1S/C36H78O9S4Si3/c1-10-37-50(38-11-2,39-12-3)30-19-26-46-48-28-23-34-21-22-35(25-32-52(43-16-7,44-17-8)45-18-9)36(33-34)24-29-49-47-27-20-31-51(40-13-4,41-14-5)42-15-6/h34-36H,10-33H2,1-9H3 |
| InChIKey | JNFDHCKAWRHNDN-UHFFFAOYSA-N |
| XLogP | 10.88 |
| TPSA | 83.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 37 |
| Heavy Atoms | 52 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 867.54 |
| LogP ≤ 5 | 10.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|