C14H29NO3Si — CID 156703702
2-(7-azabicyclo[4.1.0]heptan-3-yl)ethyl-triethoxysilane (PubChem CID 156703702) has the molecular formula C14H29NO3Si and a molecular weight of 287.48 g/mol. Its IUPAC name is 2-(7-azabicyclo[4.1.0]heptan-3-yl)ethyl-triethoxysilane.
| Compound Name | 2-(7-azabicyclo[4.1.0]heptan-3-yl)ethyl-triethoxysilane |
|---|---|
| PubChem CID | 156703702 |
| Molecular Formula | C14H29NO3Si |
| Molecular Weight | 287.48 g/mol |
| Exact Mass | 287.19 |
| IUPAC Name | 2-(7-azabicyclo[4.1.0]heptan-3-yl)ethyl-triethoxysilane |
| SMILES | CCO[Si](CCC1CCC2NC2C1)(OCC)OCC |
| InChI | InChI=1S/C14H29NO3Si/c1-4-16-19(17-5-2,18-6-3)10-9-12-7-8-13-14(11-12)15-13/h12-15H,4-11H2,1-3H3 |
| InChIKey | ZEIAKFIBCFUXMK-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 49.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.48 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|