C29H64O9S12Si3 — CID 141048417
1,1-bis(triethoxysilylmethyltetrasulfanyl)ethoxy-[(2-cyclohexylethyltetrasulfanyl)methyl]-diethoxysilane (PubChem CID 141048417) has the molecular formula C29H64O9S12Si3 and a molecular weight of 1025.88 g/mol. Its IUPAC name is 1,1-bis(triethoxysilylmethyltetrasulfanyl)ethoxy-[(2-cyclohexylethyltetrasulfanyl)methyl]-diethoxysilane.
| Compound Name | 1,1-bis(triethoxysilylmethyltetrasulfanyl)ethoxy-[(2-cyclohexylethyltetrasulfanyl)methyl]-diethoxysilane |
|---|---|
| PubChem CID | 141048417 |
| Molecular Formula | C29H64O9S12Si3 |
| Molecular Weight | 1025.88 g/mol |
| Exact Mass | 1024.05 |
| IUPAC Name | 1,1-bis(triethoxysilylmethyltetrasulfanyl)ethoxy-[(2-cyclohexylethyltetrasulfanyl)methyl]-diethoxysilane |
| SMILES | CCO[Si](CSSSSC(C)(O[Si](CSSSSCCC1CCCCC1)(OCC)OCC)SSSSC[Si](OCC)(OCC)OCC)(OCC)OCC |
| InChI | InChI=1S/C29H64O9S12Si3/c1-10-30-51(31-11-2,32-12-3)25-40-47-49-43-29(9,44-50-48-41-26-52(33-13-4,34-14-5)35-15-6)38-53(36-16-7,37-17-8)27-42-46-45-39-24-23-28-21-19-18-20-22-28/h28H,10-27H2,1-9H3 |
| InChIKey | NVKFVBLDIKFMFU-UHFFFAOYSA-N |
| XLogP | 13.41 |
| TPSA | 83.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 21 |
| Rotatable Bonds | 38 |
| Heavy Atoms | 53 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1025.88 |
| LogP ≤ 5 | 13.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 21 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|