C47H88O9S12Si3 — CID 151943364
1-bicyclo[2.2.1]heptanyl-[2-(2-cyclohexylethyltetrasulfanyl)-2,2-bis[(2-triethoxysilyl-1-bicyclo[2.2.1]heptanyl)tetrasulfanyl]ethoxy]-diethoxysilane (PubChem CID 151943364) has the molecular formula C47H88O9S12Si3 and a molecular weight of 1266.27 g/mol. Its IUPAC name is 1-bicyclo[2.2.1]heptanyl-[2-(2-cyclohexylethyltetrasulfanyl)-2,2-bis[(2-triethoxysilyl-1-bicyclo[2.2.1]heptanyl)tetrasulfanyl]ethoxy]-diethoxysilane.
| Compound Name | 1-bicyclo[2.2.1]heptanyl-[2-(2-cyclohexylethyltetrasulfanyl)-2,2-bis[(2-triethoxysilyl-1-bicyclo[2.2.1]heptanyl)tetrasulfanyl]ethoxy]-diethoxysilane |
|---|---|
| PubChem CID | 151943364 |
| Molecular Formula | C47H88O9S12Si3 |
| Molecular Weight | 1266.27 g/mol |
| Exact Mass | 1264.24 |
| IUPAC Name | 1-bicyclo[2.2.1]heptanyl-[2-(2-cyclohexylethyltetrasulfanyl)-2,2-bis[(2-triethoxysilyl-1-bicyclo[2.2.1]heptanyl)tetrasulfanyl]ethoxy]-diethoxysilane |
| SMILES | CCO[Si](OCC)(OCC)C1CC2CCC1(SSSSC(CO[Si](OCC)(OCC)C13CCC(CC1)C3)(SSSSCCC1CCCCC1)SSSSC13CCC(CC1[Si](OCC)(OCC)OCC)C3)C2 |
| InChI | InChI=1S/C47H88O9S12Si3/c1-9-48-69(49-10-2,50-11-3)42-32-40-24-29-45(42,35-40)58-64-67-61-47(60-66-63-57-31-26-38-20-18-17-19-21-38,37-56-71(54-15-7,55-16-8)44-27-22-39(34-44)23-28-44)62-68-65-59-46-30-25-41(36-46)33-43(46)70(51-12-4,52-13-5)53-14-6/h38-43H,9-37H2,1-8H3 |
| InChIKey | TVDIABVXGSUWJT-UHFFFAOYSA-N |
| XLogP | 18.73 |
| TPSA | 83.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 21 |
| Rotatable Bonds | 39 |
| Heavy Atoms | 71 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1266.27 |
| LogP ≤ 5 | 18.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 21 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|