C52H118O18S24Si6 — CID 22627780
[[2,6-dimethyl-1,1,1,2,3-pentakis(triethoxysilylmethyltetrasulfanyl)octan-3-yl]tetrasulfanyl]methyl-triethoxysilane (PubChem CID 22627780) has the molecular formula C52H118O18S24Si6 and a molecular weight of 1969.62 g/mol. Its IUPAC name is [[2,6-dimethyl-1,1,1,2,3-pentakis(triethoxysilylmethyltetrasulfanyl)octan-3-yl]tetrasulfanyl]methyl-triethoxysilane.
| Compound Name | [[2,6-dimethyl-1,1,1,2,3-pentakis(triethoxysilylmethyltetrasulfanyl)octan-3-yl]tetrasulfanyl]methyl-triethoxysilane |
|---|---|
| PubChem CID | 22627780 |
| Molecular Formula | C52H118O18S24Si6 |
| Molecular Weight | 1969.62 g/mol |
| Exact Mass | 1966.02 |
| IUPAC Name | [[2,6-dimethyl-1,1,1,2,3-pentakis(triethoxysilylmethyltetrasulfanyl)octan-3-yl]tetrasulfanyl]methyl-triethoxysilane |
| SMILES | CCO[Si](CSSSSC(CCC(C)CC)(SSSSC[Si](OCC)(OCC)OCC)C(C)(SSSSC[Si](OCC)(OCC)OCC)C(SSSSC[Si](OCC)(OCC)OCC)(SSSSC[Si](OCC)(OCC)OCC)SSSSC[Si](OCC)(OCC)OCC)(OCC)OCC |
| InChI | InChI=1S/C52H118O18S24Si6/c1-22-49(20)41-42-51(78-90-84-72-44-96(56-26-5,57-27-6)58-28-7,79-91-85-73-45-97(59-29-8,60-30-9)61-31-10)50(21,77-89-83-71-43-95(53-23-2,54-24-3)55-25-4)52(80-92-86-74-46-98(62-32-11,63-33-12)64-34-13,81-93-87-75-47-99(65-35-14,66-36-15)67-37-16)82-94-88-76-48-100(68-38-17,69-39-18)70-40-19/h49H,22-48H2,1-21H3 |
| InChIKey | KZWZATOGJAOGTQ-UHFFFAOYSA-N |
| XLogP | 24.51 |
| TPSA | 166.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 42 |
| Rotatable Bonds | 78 |
| Heavy Atoms | 100 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1969.62 |
| LogP ≤ 5 | 24.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 42 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|