C55H122O15S20Si5 — CID 22627753
3-[[2,6-dimethyl-1,1,1,2-tetrakis(3-triethoxysilylpropyltetrasulfanyl)octan-3-yl]tetrasulfanyl]propyl-triethoxysilane (PubChem CID 22627753) has the molecular formula C55H122O15S20Si5 and a molecular weight of 1805.34 g/mol. Its IUPAC name is 3-[[2,6-dimethyl-1,1,1,2-tetrakis(3-triethoxysilylpropyltetrasulfanyl)octan-3-yl]tetrasulfanyl]propyl-triethoxysilane.
| Compound Name | 3-[[2,6-dimethyl-1,1,1,2-tetrakis(3-triethoxysilylpropyltetrasulfanyl)octan-3-yl]tetrasulfanyl]propyl-triethoxysilane |
|---|---|
| PubChem CID | 22627753 |
| Molecular Formula | C55H122O15S20Si5 |
| Molecular Weight | 1805.34 g/mol |
| Exact Mass | 1802.20 |
| IUPAC Name | 3-[[2,6-dimethyl-1,1,1,2-tetrakis(3-triethoxysilylpropyltetrasulfanyl)octan-3-yl]tetrasulfanyl]propyl-triethoxysilane |
| SMILES | CCO[Si](CCCSSSSC(CCC(C)CC)C(C)(SSSSCCC[Si](OCC)(OCC)OCC)C(SSSSCCC[Si](OCC)(OCC)OCC)(SSSSCCC[Si](OCC)(OCC)OCC)SSSSCCC[Si](OCC)(OCC)OCC)(OCC)OCC |
| InChI | InChI=1S/C55H122O15S20Si5/c1-19-52(17)40-41-53(76-86-81-71-42-35-47-91(56-20-2,57-21-3)58-22-4)54(18,77-87-82-72-43-36-48-92(59-23-5,60-24-6)61-25-7)55(78-88-83-73-44-37-49-93(62-26-8,63-27-9)64-28-10,79-89-84-74-45-38-50-94(65-29-11,66-30-12)67-31-13)80-90-85-75-46-39-51-95(68-32-14,69-33-15)70-34-16/h52-53H,19-51H2,1-18H3 |
| InChIKey | QDDGBNQFYLSKEY-UHFFFAOYSA-N |
| XLogP | 25.18 |
| TPSA | 138.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 35 |
| Rotatable Bonds | 76 |
| Heavy Atoms | 95 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1805.34 |
| LogP ≤ 5 | 25.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 35 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|