C21H48O3S4Si2 — CID 162193631
triethoxy-[2-ethyl-4-[3-(trimethylsilylmethyl)pentyltetrasulfanyl]butyl]silane (PubChem CID 162193631) has the molecular formula C21H48O3S4Si2 and a molecular weight of 533.05 g/mol. Its IUPAC name is triethoxy-[2-ethyl-4-[3-(trimethylsilylmethyl)pentyltetrasulfanyl]butyl]silane.
| Compound Name | triethoxy-[2-ethyl-4-[3-(trimethylsilylmethyl)pentyltetrasulfanyl]butyl]silane |
|---|---|
| PubChem CID | 162193631 |
| Molecular Formula | C21H48O3S4Si2 |
| Molecular Weight | 533.05 g/mol |
| Exact Mass | 532.20 |
| IUPAC Name | triethoxy-[2-ethyl-4-[3-(trimethylsilylmethyl)pentyltetrasulfanyl]butyl]silane |
| SMILES | CCO[Si](CC(CC)CCSSSSCCC(CC)C[Si](C)(C)C)(OCC)OCC |
| InChI | InChI=1S/C21H48O3S4Si2/c1-9-20(18-29(6,7)8)14-16-25-27-28-26-17-15-21(10-2)19-30(22-11-3,23-12-4)24-13-5/h20-21H,9-19H2,1-8H3 |
| InChIKey | WSDHMXUXNGZADE-UHFFFAOYSA-N |
| XLogP | 8.88 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.05 |
| LogP ≤ 5 | 8.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|