C17H35NO6Si — CID 87629505
diethyl 2-[[4-[dimethoxy(methyl)silyl]-2,2-dimethylbutyl]amino]butanedioate (PubChem CID 87629505) has the molecular formula C17H35NO6Si and a molecular weight of 377.55 g/mol. Its IUPAC name is diethyl 2-[[4-[dimethoxy(methyl)silyl]-2,2-dimethylbutyl]amino]butanedioate.
| Compound Name | diethyl 2-[[4-[dimethoxy(methyl)silyl]-2,2-dimethylbutyl]amino]butanedioate |
|---|---|
| PubChem CID | 87629505 |
| Molecular Formula | C17H35NO6Si |
| Molecular Weight | 377.55 g/mol |
| Exact Mass | 377.22 |
| IUPAC Name | diethyl 2-[[4-[dimethoxy(methyl)silyl]-2,2-dimethylbutyl]amino]butanedioate |
| SMILES | CCOC(=O)CC(NCC(C)(C)CC[Si](C)(OC)OC)C(=O)OCC |
| InChI | InChI=1S/C17H35NO6Si/c1-8-23-15(19)12-14(16(20)24-9-2)18-13-17(3,4)10-11-25(7,21-5)22-6/h14,18H,8-13H2,1-7H3 |
| InChIKey | YUXYFTZVDNVGSP-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 83.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.55 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|