C15H22Cl2N4O3 — CID 139880242
[7-(carbamoylamino)-5-(3,5-dichlorophenoxy)heptan-3-yl]urea (PubChem CID 139880242) has the molecular formula C15H22Cl2N4O3 and a molecular weight of 377.27 g/mol. Its IUPAC name is [7-(carbamoylamino)-5-(3,5-dichlorophenoxy)heptan-3-yl]urea.
| Compound Name | [7-(carbamoylamino)-5-(3,5-dichlorophenoxy)heptan-3-yl]urea |
|---|---|
| PubChem CID | 139880242 |
| Molecular Formula | C15H22Cl2N4O3 |
| Molecular Weight | 377.27 g/mol |
| Exact Mass | 376.11 |
| IUPAC Name | [7-(carbamoylamino)-5-(3,5-dichlorophenoxy)heptan-3-yl]urea |
| SMILES | CCC(CC(CCNC(N)=O)Oc1cc(Cl)cc(Cl)c1)NC(N)=O |
| InChI | InChI=1S/C15H22Cl2N4O3/c1-2-11(21-15(19)23)8-12(3-4-20-14(18)22)24-13-6-9(16)5-10(17)7-13/h5-7,11-12H,2-4,8H2,1H3,(H3,18,20,22)(H3,19,21,23) |
| InChIKey | LIWPXQGARCKWAQ-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 119.47 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.27 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |