C15H23Cl2NO — CID 83044887
N-tert-butyl-2-(3,5-dichlorophenoxy)pentan-1-amine (PubChem CID 83044887) has the molecular formula C15H23Cl2NO and a molecular weight of 304.26 g/mol. Its IUPAC name is N-tert-butyl-2-(3,5-dichlorophenoxy)pentan-1-amine.
| Compound Name | N-tert-butyl-2-(3,5-dichlorophenoxy)pentan-1-amine |
|---|---|
| PubChem CID | 83044887 |
| Molecular Formula | C15H23Cl2NO |
| Molecular Weight | 304.26 g/mol |
| Exact Mass | 303.12 |
| IUPAC Name | N-tert-butyl-2-(3,5-dichlorophenoxy)pentan-1-amine |
| SMILES | CCCC(CNC(C)(C)C)Oc1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C15H23Cl2NO/c1-5-6-13(10-18-15(2,3)4)19-14-8-11(16)7-12(17)9-14/h7-9,13,18H,5-6,10H2,1-4H3 |
| InChIKey | SPDPZLNHEOWCHZ-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.26 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |