C15H24INO — CID 83044883
N-tert-butyl-2-(3-iodophenoxy)pentan-1-amine (PubChem CID 83044883) has the molecular formula C15H24INO and a molecular weight of 361.27 g/mol. Its IUPAC name is N-tert-butyl-2-(3-iodophenoxy)pentan-1-amine.
| Compound Name | N-tert-butyl-2-(3-iodophenoxy)pentan-1-amine |
|---|---|
| PubChem CID | 83044883 |
| Molecular Formula | C15H24INO |
| Molecular Weight | 361.27 g/mol |
| Exact Mass | 361.09 |
| IUPAC Name | N-tert-butyl-2-(3-iodophenoxy)pentan-1-amine |
| SMILES | CCCC(CNC(C)(C)C)Oc1cccc(I)c1 |
| InChI | InChI=1S/C15H24INO/c1-5-7-14(11-17-15(2,3)4)18-13-9-6-8-12(16)10-13/h6,8-10,14,17H,5,7,11H2,1-4H3 |
| InChIKey | GGRGURMQAUKBNQ-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.27 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|