C10H9Cl3O2 — CID 13239466
2-(3,5-dichlorophenoxy)butanoyl chloride (PubChem CID 13239466) has the molecular formula C10H9Cl3O2 and a molecular weight of 267.54 g/mol. Its IUPAC name is 2-(3,5-dichlorophenoxy)butanoyl chloride.
| Compound Name | 2-(3,5-dichlorophenoxy)butanoyl chloride |
|---|---|
| PubChem CID | 13239466 |
| Molecular Formula | C10H9Cl3O2 |
| Molecular Weight | 267.54 g/mol |
| Exact Mass | 265.97 |
| IUPAC Name | 2-(3,5-dichlorophenoxy)butanoyl chloride |
| SMILES | CCC(Oc1cc(Cl)cc(Cl)c1)C(=O)Cl |
| InChI | InChI=1S/C10H9Cl3O2/c1-2-9(10(13)14)15-8-4-6(11)3-7(12)5-8/h3-5,9H,2H2,1H3 |
| InChIKey | UFWSTLURZCKNHB-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.54 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|