2-(4-chloro-3,5-dimethylphenoxy)butanoic acid

C12H15ClO3 — CID 13218780

IUPAC2-(4-chloro-3,5-dimethylphenoxy)butanoic acid
SMILESCCC(Oc1cc(C)c(Cl)c(C)c1)C(=O)O
InChIInChI=1S/C12H15ClO3/c1-4-10(12(14)15)16-9-5-7(2)11(13)8(3)6-9/h5-6,10H,4H2,1-3H3,(H,14,15)
InChIKeySBQVJRJGCJTRLY-UHFFFAOYSA-N
MW242.70 g/mol
LogP3.20
Rot. Bonds4

About 2-(4-chloro-3,5-dimethylphenoxy)butanoic acid

2-(4-chloro-3,5-dimethylphenoxy)butanoic acid (PubChem CID 13218780) has the molecular formula C12H15ClO3 and a molecular weight of 242.70 g/mol. Its IUPAC name is 2-(4-chloro-3,5-dimethylphenoxy)butanoic acid.

Molecular Properties

Compound Name2-(4-chloro-3,5-dimethylphenoxy)butanoic acid
PubChem CID13218780
Molecular FormulaC12H15ClO3
Molecular Weight242.70 g/mol
Exact Mass242.07
IUPAC Name2-(4-chloro-3,5-dimethylphenoxy)butanoic acid
SMILESCCC(Oc1cc(C)c(Cl)c(C)c1)C(=O)O
InChIInChI=1S/C12H15ClO3/c1-4-10(12(14)15)16-9-5-7(2)11(13)8(3)6-9/h5-6,10H,4H2,1-3H3,(H,14,15)
InChIKeySBQVJRJGCJTRLY-UHFFFAOYSA-N
XLogP3.20
TPSA46.53 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds4
Heavy Atoms16
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500242.70
LogP ≤ 53.20
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Analyze 2-(4-chloro-3,5-dimethylphenoxy)butanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(4-chloro-3,5-dimethylphenoxy)butanoic acid?
The IUPAC name of 2-(4-chloro-3,5-dimethylphenoxy)butanoic acid (CID 13218780) is 2-(4-chloro-3,5-dimethylphenoxy)butanoic acid.
What is the SMILES notation for 2-(4-chloro-3,5-dimethylphenoxy)butanoic acid?
The canonical SMILES for 2-(4-chloro-3,5-dimethylphenoxy)butanoic acid is CCC(Oc1cc(C)c(Cl)c(C)c1)C(=O)O.
What is the InChIKey of 2-(4-chloro-3,5-dimethylphenoxy)butanoic acid?
The InChIKey is SBQVJRJGCJTRLY-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H15ClO3/c1-4-10(12(14)15)16-9-5-7(2)11(13)8(3)6-9/h5-6,10H,4H2,1-3H3,(H,14,15).
What are the key properties of 2-(4-chloro-3,5-dimethylphenoxy)butanoic acid?
2-(4-chloro-3,5-dimethylphenoxy)butanoic acid has a molecular weight of 242.70 g/mol, XLogP of 3.20, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-chloro-3,5-dimethylphenoxy)butanoic acid is sourced from PubChem (CID 13218780), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).