C16H24O3 — CID 6938805
(2R)-2-[3-methyl-4-(2-methylbutan-2-yl)phenoxy]butanoic acid (PubChem CID 6938805) has the molecular formula C16H24O3 and a molecular weight of 264.37 g/mol. Its IUPAC name is (2R)-2-[3-methyl-4-(2-methylbutan-2-yl)phenoxy]butanoic acid.
| Compound Name | (2R)-2-[3-methyl-4-(2-methylbutan-2-yl)phenoxy]butanoic acid |
|---|---|
| PubChem CID | 6938805 |
| Molecular Formula | C16H24O3 |
| Molecular Weight | 264.37 g/mol |
| Exact Mass | 264.17 |
| IUPAC Name | (2R)-2-[3-methyl-4-(2-methylbutan-2-yl)phenoxy]butanoic acid |
| SMILES | CC[C@@H](Oc1ccc(C(C)(C)CC)c(C)c1)C(=O)O |
| InChI | InChI=1S/C16H24O3/c1-6-14(15(17)18)19-12-8-9-13(11(3)10-12)16(4,5)7-2/h8-10,14H,6-7H2,1-5H3,(H,17,18)/t14-/m1/s1 |
| InChIKey | WOXMPVQWLXTUKL-CQSZACIVSA-N |
| XLogP | 3.92 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.37 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |