C16H19Cl2NO4 — CID 178117843
(E)-4-[2-(3,5-dichlorophenoxy)butanoylamino]-4-methylpent-2-enoic acid (PubChem CID 178117843) has the molecular formula C16H19Cl2NO4 and a molecular weight of 360.24 g/mol. Its IUPAC name is (E)-4-[2-(3,5-dichlorophenoxy)butanoylamino]-4-methylpent-2-enoic acid.
| Compound Name | (E)-4-[2-(3,5-dichlorophenoxy)butanoylamino]-4-methylpent-2-enoic acid |
|---|---|
| PubChem CID | 178117843 |
| Molecular Formula | C16H19Cl2NO4 |
| Molecular Weight | 360.24 g/mol |
| Exact Mass | 359.07 |
| IUPAC Name | (E)-4-[2-(3,5-dichlorophenoxy)butanoylamino]-4-methylpent-2-enoic acid |
| SMILES | CCC(Oc1cc(Cl)cc(Cl)c1)C(=O)NC(C)(C)/C=C/C(=O)O |
| InChI | InChI=1S/C16H19Cl2NO4/c1-4-13(23-12-8-10(17)7-11(18)9-12)15(22)19-16(2,3)6-5-14(20)21/h5-9,13H,4H2,1-3H3,(H,19,22)(H,20,21)/b6-5+ |
| InChIKey | OOQBMRZWLWXYTL-AATRIKPKSA-N |
| XLogP | 3.69 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.24 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|