C17H22FNO4 — CID 178117836
(E)-4-[2-(3-fluoro-5-methylphenoxy)butanoylamino]-4-methylpent-2-enoic acid (PubChem CID 178117836) has the molecular formula C17H22FNO4 and a molecular weight of 323.36 g/mol. Its IUPAC name is (E)-4-[2-(3-fluoro-5-methylphenoxy)butanoylamino]-4-methylpent-2-enoic acid.
| Compound Name | (E)-4-[2-(3-fluoro-5-methylphenoxy)butanoylamino]-4-methylpent-2-enoic acid |
|---|---|
| PubChem CID | 178117836 |
| Molecular Formula | C17H22FNO4 |
| Molecular Weight | 323.36 g/mol |
| Exact Mass | 323.15 |
| IUPAC Name | (E)-4-[2-(3-fluoro-5-methylphenoxy)butanoylamino]-4-methylpent-2-enoic acid |
| SMILES | CCC(Oc1cc(C)cc(F)c1)C(=O)NC(C)(C)/C=C/C(=O)O |
| InChI | InChI=1S/C17H22FNO4/c1-5-14(23-13-9-11(2)8-12(18)10-13)16(22)19-17(3,4)7-6-15(20)21/h6-10,14H,5H2,1-4H3,(H,19,22)(H,20,21)/b7-6+ |
| InChIKey | RNCDGNQQZCZVBI-VOTSOKGWSA-N |
| XLogP | 2.83 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.36 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|