C17H21ClFNO4 — CID 178117837
methyl (E)-4-[2-(3-chloro-5-fluorophenoxy)butanoylamino]-4-methylpent-2-enoate (PubChem CID 178117837) has the molecular formula C17H21ClFNO4 and a molecular weight of 357.81 g/mol. Its IUPAC name is methyl (E)-4-[2-(3-chloro-5-fluorophenoxy)butanoylamino]-4-methylpent-2-enoate.
| Compound Name | methyl (E)-4-[2-(3-chloro-5-fluorophenoxy)butanoylamino]-4-methylpent-2-enoate |
|---|---|
| PubChem CID | 178117837 |
| Molecular Formula | C17H21ClFNO4 |
| Molecular Weight | 357.81 g/mol |
| Exact Mass | 357.11 |
| IUPAC Name | methyl (E)-4-[2-(3-chloro-5-fluorophenoxy)butanoylamino]-4-methylpent-2-enoate |
| SMILES | CCC(Oc1cc(F)cc(Cl)c1)C(=O)NC(C)(C)/C=C/C(=O)OC |
| InChI | InChI=1S/C17H21ClFNO4/c1-5-14(24-13-9-11(18)8-12(19)10-13)16(22)20-17(2,3)7-6-15(21)23-4/h6-10,14H,5H2,1-4H3,(H,20,22)/b7-6+ |
| InChIKey | YTRMRJDGXHMNFA-VOTSOKGWSA-N |
| XLogP | 3.26 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.81 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|