C17H23ClN2O2 — CID 21078391
2-[(5-chloro-3-pyridinyl)oxy]-N-(2-methylhept-3-yn-2-yl)butanamide (PubChem CID 21078391) has the molecular formula C17H23ClN2O2 and a molecular weight of 322.84 g/mol. Its IUPAC name is 2-[(5-chloro-3-pyridinyl)oxy]-N-(2-methylhept-3-yn-2-yl)butanamide.
| Compound Name | 2-[(5-chloro-3-pyridinyl)oxy]-N-(2-methylhept-3-yn-2-yl)butanamide |
|---|---|
| PubChem CID | 21078391 |
| Molecular Formula | C17H23ClN2O2 |
| Molecular Weight | 322.84 g/mol |
| Exact Mass | 322.14 |
| IUPAC Name | 2-[(5-chloro-3-pyridinyl)oxy]-N-(2-methylhept-3-yn-2-yl)butanamide |
| SMILES | CCCC#CC(C)(C)NC(=O)C(CC)Oc1cncc(Cl)c1 |
| InChI | InChI=1S/C17H23ClN2O2/c1-5-7-8-9-17(3,4)20-16(21)15(6-2)22-14-10-13(18)11-19-12-14/h10-12,15H,5-7H2,1-4H3,(H,20,21) |
| InChIKey | ZFTTXPDNRWUVTO-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.84 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|