C15H17Cl2NO3S — CID 67004987
2-(3,5-dichlorophenoxy)-N-(2-methylpent-3-yn-2-yl)-2-methylsulfinylacetamide (PubChem CID 67004987) has the molecular formula C15H17Cl2NO3S and a molecular weight of 362.28 g/mol. Its IUPAC name is 2-(3,5-dichlorophenoxy)-N-(2-methylpent-3-yn-2-yl)-2-methylsulfinylacetamide.
| Compound Name | 2-(3,5-dichlorophenoxy)-N-(2-methylpent-3-yn-2-yl)-2-methylsulfinylacetamide |
|---|---|
| PubChem CID | 67004987 |
| Molecular Formula | C15H17Cl2NO3S |
| Molecular Weight | 362.28 g/mol |
| Exact Mass | 361.03 |
| IUPAC Name | 2-(3,5-dichlorophenoxy)-N-(2-methylpent-3-yn-2-yl)-2-methylsulfinylacetamide |
| SMILES | CC#CC(C)(C)NC(=O)C(Oc1cc(Cl)cc(Cl)c1)S(C)=O |
| InChI | InChI=1S/C15H17Cl2NO3S/c1-5-6-15(2,3)18-13(19)14(22(4)20)21-12-8-10(16)7-11(17)9-12/h7-9,14H,1-4H3,(H,18,19) |
| InChIKey | CFPQNDNXTDNXOQ-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.28 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|