C22H33Cl2NO3Si — CID 173117126
2-(3,5-dichlorophenoxy)-N-(5-dimethylsilyloxy-2,6,6-trimethylhept-3-yn-2-yl)butanamide (PubChem CID 173117126) has the molecular formula C22H33Cl2NO3Si and a molecular weight of 458.50 g/mol. Its IUPAC name is 2-(3,5-dichlorophenoxy)-N-(5-dimethylsilyloxy-2,6,6-trimethylhept-3-yn-2-yl)butanamide.
| Compound Name | 2-(3,5-dichlorophenoxy)-N-(5-dimethylsilyloxy-2,6,6-trimethylhept-3-yn-2-yl)butanamide |
|---|---|
| PubChem CID | 173117126 |
| Molecular Formula | C22H33Cl2NO3Si |
| Molecular Weight | 458.50 g/mol |
| Exact Mass | 457.16 |
| IUPAC Name | 2-(3,5-dichlorophenoxy)-N-(5-dimethylsilyloxy-2,6,6-trimethylhept-3-yn-2-yl)butanamide |
| SMILES | CCC(Oc1cc(Cl)cc(Cl)c1)C(=O)NC(C)(C)C#CC(O[SiH](C)C)C(C)(C)C |
| InChI | InChI=1S/C22H33Cl2NO3Si/c1-9-18(27-17-13-15(23)12-16(24)14-17)20(26)25-22(5,6)11-10-19(21(2,3)4)28-29(7)8/h12-14,18-19,29H,9H2,1-8H3,(H,25,26) |
| InChIKey | YONQFEMUWJKSCB-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.50 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|