C16H18ClF2NO4 — CID 178117900
(E)-4-[2-(4-chloro-3,5-difluorophenoxy)butanoylamino]-4-methylpent-2-enoic acid (PubChem CID 178117900) has the molecular formula C16H18ClF2NO4 and a molecular weight of 361.77 g/mol. Its IUPAC name is (E)-4-[2-(4-chloro-3,5-difluorophenoxy)butanoylamino]-4-methylpent-2-enoic acid.
| Compound Name | (E)-4-[2-(4-chloro-3,5-difluorophenoxy)butanoylamino]-4-methylpent-2-enoic acid |
|---|---|
| PubChem CID | 178117900 |
| Molecular Formula | C16H18ClF2NO4 |
| Molecular Weight | 361.77 g/mol |
| Exact Mass | 361.09 |
| IUPAC Name | (E)-4-[2-(4-chloro-3,5-difluorophenoxy)butanoylamino]-4-methylpent-2-enoic acid |
| SMILES | CCC(Oc1cc(F)c(Cl)c(F)c1)C(=O)NC(C)(C)/C=C/C(=O)O |
| InChI | InChI=1S/C16H18ClF2NO4/c1-4-12(15(23)20-16(2,3)6-5-13(21)22)24-9-7-10(18)14(17)11(19)8-9/h5-8,12H,4H2,1-3H3,(H,20,23)(H,21,22)/b6-5+ |
| InChIKey | PTODWCKFLQTNDM-AATRIKPKSA-N |
| XLogP | 3.31 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.77 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|