C19H27NO4 — CID 178117830
methyl (E)-4-[[(2R)-2-(3,5-dimethylphenoxy)butanoyl]amino]-4-methylpent-2-enoate (PubChem CID 178117830) has the molecular formula C19H27NO4 and a molecular weight of 333.43 g/mol. Its IUPAC name is methyl (E)-4-[[(2R)-2-(3,5-dimethylphenoxy)butanoyl]amino]-4-methylpent-2-enoate.
| Compound Name | methyl (E)-4-[[(2R)-2-(3,5-dimethylphenoxy)butanoyl]amino]-4-methylpent-2-enoate |
|---|---|
| PubChem CID | 178117830 |
| Molecular Formula | C19H27NO4 |
| Molecular Weight | 333.43 g/mol |
| Exact Mass | 333.19 |
| IUPAC Name | methyl (E)-4-[[(2R)-2-(3,5-dimethylphenoxy)butanoyl]amino]-4-methylpent-2-enoate |
| SMILES | CC[C@@H](Oc1cc(C)cc(C)c1)C(=O)NC(C)(C)/C=C/C(=O)OC |
| InChI | InChI=1S/C19H27NO4/c1-7-16(24-15-11-13(2)10-14(3)12-15)18(22)20-19(4,5)9-8-17(21)23-6/h8-12,16H,7H2,1-6H3,(H,20,22)/b9-8+/t16-/m1/s1 |
| InChIKey | AJCNPRFXMCEGJQ-ROJDOSBLSA-N |
| XLogP | 3.08 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.43 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|