C23H30N2O3 — CID 132657650
N-tert-butyl-2-[2-(3,5-dimethylphenoxy)butanoylamino]benzamide (PubChem CID 132657650) has the molecular formula C23H30N2O3 and a molecular weight of 382.50 g/mol. Its IUPAC name is N-tert-butyl-2-[2-(3,5-dimethylphenoxy)butanoylamino]benzamide.
| Compound Name | N-tert-butyl-2-[2-(3,5-dimethylphenoxy)butanoylamino]benzamide |
|---|---|
| PubChem CID | 132657650 |
| Molecular Formula | C23H30N2O3 |
| Molecular Weight | 382.50 g/mol |
| Exact Mass | 382.23 |
| IUPAC Name | N-tert-butyl-2-[2-(3,5-dimethylphenoxy)butanoylamino]benzamide |
| SMILES | CCC(Oc1cc(C)cc(C)c1)C(=O)Nc1ccccc1C(=O)NC(C)(C)C |
| InChI | InChI=1S/C23H30N2O3/c1-7-20(28-17-13-15(2)12-16(3)14-17)22(27)24-19-11-9-8-10-18(19)21(26)25-23(4,5)6/h8-14,20H,7H2,1-6H3,(H,24,27)(H,25,26) |
| InChIKey | UIUKWLCIGRAUEZ-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.50 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |