C30H29N3O3 — CID 42426923
N-(4-anilinophenyl)-2-[[(2R)-2-(4-methylphenoxy)butanoyl]amino]benzamide (PubChem CID 42426923) has the molecular formula C30H29N3O3 and a molecular weight of 479.58 g/mol. Its IUPAC name is N-(4-anilinophenyl)-2-[[(2R)-2-(4-methylphenoxy)butanoyl]amino]benzamide.
| Compound Name | N-(4-anilinophenyl)-2-[[(2R)-2-(4-methylphenoxy)butanoyl]amino]benzamide |
|---|---|
| PubChem CID | 42426923 |
| Molecular Formula | C30H29N3O3 |
| Molecular Weight | 479.58 g/mol |
| Exact Mass | 479.22 |
| IUPAC Name | N-(4-anilinophenyl)-2-[[(2R)-2-(4-methylphenoxy)butanoyl]amino]benzamide |
| SMILES | CC[C@@H](Oc1ccc(C)cc1)C(=O)Nc1ccccc1C(=O)Nc1ccc(Nc2ccccc2)cc1 |
| InChI | InChI=1S/C30H29N3O3/c1-3-28(36-25-19-13-21(2)14-20-25)30(35)33-27-12-8-7-11-26(27)29(34)32-24-17-15-23(16-18-24)31-22-9-5-4-6-10-22/h4-20,28,31H,3H2,1-2H3,(H,32,34)(H,33,35)/t28-/m1/s1 |
| InChIKey | ZWRBOILAJJKARA-MUUNZHRXSA-N |
| XLogP | 6.79 |
| TPSA | 79.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.58 |
| LogP ≤ 5 | 6.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |